| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:21:33 UTC |
|---|
| Update Date | 2025-03-21 18:37:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00114098 |
|---|
| Frequency | 23.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H20O11 |
|---|
| Molecular Mass | 448.1006 |
|---|
| SMILES | O=C1c2cc(OC3OC(C(=O)O)C(O)C(O)C3O)c(O)cc2OCC1c1ccc(O)cc1 |
|---|
| InChI Key | JXUDRNDLUIPGSQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflavonoid o-glycosides |
|---|
| Direct Parent | isoflavonoid o-glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalsalkyl aryl ethersaryl alkyl ketonesbenzene and substituted derivativesbeta hydroxy acids and derivativescarboxylic acidschromonesglucuronic acid derivativeshydrocarbon derivativesisoflavanolsisoflavanonesmonocarboxylic acids and derivativesmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanesphenol etherspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidaryl alkyl ketoneglucuronic acid or derivatives1-benzopyranisoflavonoid-6-o-glycosideisoflavanolo-glucuronide1-hydroxy-2-unsubstituted benzenoidmonosaccharidealkyl aryl ethercarboxylic acid derivativepyran carboxylic acidisoflavanoneketone1-o-glucuronidebeta-hydroxy acidsaccharideorganic oxideacetalchromonearomatic heteropolycyclic compoundchromaneoxaneorganoheterocyclic compoundalcoholisoflavanbenzopyranpyran carboxylic acid or derivativesisoflavonoid o-glycosidehydroxy acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyransecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|
