| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:21:48 UTC |
|---|
| Update Date | 2025-03-21 18:37:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00114696 |
|---|
| Frequency | 23.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H10O4 |
|---|
| Molecular Mass | 218.0579 |
|---|
| SMILES | COc1cc2cc(C(=O)O)ccc2cc1O |
|---|
| InChI Key | HHMFAWAGTGXBEQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalenecarboxylic acids and derivatives |
|---|
| Direct Parent | naphthalenecarboxylic acids |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesnaphthols and derivativesorganic oxides |
|---|
| Substituents | phenol etherethercarboxylic acid1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundalkyl aryl ethercarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundanisolehydrocarbon derivative2-naphthalenecarboxylic acid2-naphtholorganooxygen compound |
|---|
