| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:21:57 UTC |
|---|
| Update Date | 2025-03-21 18:37:19 UTC |
|---|
| HMDB ID | HMDB0029564 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00115062 |
|---|
| Name | Bufotenine O-glucoside |
|---|
| Frequency | 22.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H26N2O6 |
|---|
| Molecular Mass | 366.1791 |
|---|
| SMILES | CN(C)CCc1c[nH]c2ccc(OC3OC(CO)C(O)C(O)C3O)cc12 |
|---|
| InChI Key | GNUFCIHWKPAEBF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | Not Available |
|---|
| Subclass | alkaloids and derivatives |
|---|
| Direct Parent | alkaloids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesindolesmonosaccharidesorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersprimary alcoholspyrrolessecondary alcoholstrialkylamines |
|---|
| Substituents | phenol etherindolemonosaccharidesaccharideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholtertiary amineorganoheterocyclic compoundalcoholazacycleheteroaromatic compoundtertiary aliphatic amineindole or derivativesoxacyclealkaloid or derivativesorganic oxygen compoundpyrrolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
