| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:21:57 UTC |
|---|
| Update Date | 2025-03-21 18:37:19 UTC |
|---|
| HMDB ID | HMDB0061345 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00115100 |
|---|
| Name | N,N,O-Tridesmethylvenlafaxine |
|---|
| Frequency | 22.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H21NO2 |
|---|
| Molecular Mass | 235.1572 |
|---|
| SMILES | NCC(c1ccc(O)cc1)C1(O)CCCCC1 |
|---|
| InChI Key | BHCUWXACHAFFSK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativescyclic alcohols and derivativeshydrocarbon derivativesmonoalkylaminesorganonitrogen compoundsorganopnictogen compoundstertiary alcohols |
|---|
| Substituents | monocyclic benzene moietycyclohexanol1-hydroxy-2-unsubstituted benzenoidcyclic alcoholaromatic homomonocyclic compoundtertiary alcoholorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compound |
|---|
