| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:21:59 UTC |
|---|
| Update Date | 2025-03-21 18:37:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00115143 |
|---|
| Frequency | 33.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H13N2O10PS |
|---|
| Molecular Mass | 384.0029 |
|---|
| SMILES | O=C(O)c1cc(=O)[nH]c(=O)n1C1OC(COP(O)(O)=S)C(O)C1O |
|---|
| InChI Key | DNMHRDALHJXMPW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrimidine nucleosides |
|---|
| Subclass | pyrimidine nucleosides |
|---|
| Direct Parent | pyrimidine nucleosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativeslactamsmonocarboxylic acids and derivativesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspyrimidinecarboxylic acidspyrimidonessecondary alcoholstetrahydrofuransthiophosphate monoestersvinylogous amides |
|---|
| Substituents | lactamcarboxylic acidaromatic heteromonocyclic compoundthiophosphoric acid estermonosaccharidepyrimidonecarboxylic acid derivativethiophosphate monoesterpyrimidineorganic thiophosphoric acid or derivativessaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundpyrimidine nucleosidepyrimidine-6-carboxylic acidorganoheterocyclic compound1,2-diolalcoholvinylogous amidecarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundpyrimidine-6-carboxylic acid or derivativesorganooxygen compound |
|---|
