| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:22:03 UTC |
|---|
| Update Date | 2025-03-21 18:37:21 UTC |
|---|
| HMDB ID | HMDB0015210 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00115311 |
|---|
| Name | Etidronic acid |
|---|
| Frequency | 22.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C2H8O7P2 |
|---|
| Molecular Mass | 205.9745 |
|---|
| SMILES | CC(O)(P(=O)(O)O)P(=O)(O)O |
|---|
| InChI Key | DBVJJBKOTRCVKF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphonic acids and derivatives |
|---|
| Subclass | bisphosphonates |
|---|
| Direct Parent | bisphosphonates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganooxygen compoundsorganophosphorus compoundsorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundbisphosphonateorganic oxideorganic oxygen compoundorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeorganooxygen compound |
|---|
