| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:22:05 UTC |
|---|
| Update Date | 2025-03-21 18:37:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00115393 |
|---|
| Frequency | 22.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C37H46N4O7 |
|---|
| Molecular Mass | 658.3366 |
|---|
| SMILES | CC(=O)CCc1c2[nH]c(c1C)Cc1[nH]c(c(C)c1CCC(=O)O)Cc1[nH]c(c(C)c1CCC(=O)O)Cc1[nH]c(c(C)c1CCC(=O)O)C2 |
|---|
| InChI Key | YUPRRLZYAHNNGS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | tetrapyrroles and derivatives |
|---|
| Subclass | metallotetrapyrroles |
|---|
| Direct Parent | metalloporphyrins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesketonesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsporphyrinspyrrolestricarboxylic acids and derivatives |
|---|
| Substituents | carbonyl groupporphyrincarboxylic acidazacycleheteroaromatic compoundtricarboxylic acid or derivativescarboxylic acid derivativeketoneorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundmetalloporphyrin |
|---|
