| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:22:10 UTC |
|---|
| Update Date | 2025-03-21 18:37:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00115596 |
|---|
| Frequency | 22.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H3Cl3O3 |
|---|
| Molecular Mass | 239.9148 |
|---|
| SMILES | O=C(O)c1cc(Cl)c(Cl)c(Cl)c1O |
|---|
| InChI Key | LTBFHRWFTNPESC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | salicylic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds3-halobenzoic acids4-halobenzoic acidsaryl chloridesbenzoic acidsbenzoyl derivativeschlorobenzeneshalobenzoic acidshalophenolshydrocarbon derivativesm-chlorophenolsmonocarboxylic acids and derivativeso-chlorophenolsorganic oxidesorganochloridesorganooxygen compoundsp-chlorophenolsvinylogous acids |
|---|
| Substituents | carboxylic acid3-halobenzoic acid or derivativesorganochloridebenzoylsalicylic acidcarboxylic acid derivativeorganohalogen compoundorganic oxide3-halobenzoic acid4-halophenol1-carboxy-2-haloaromatic compoundbenzoic acidaryl chloride2-chlorophenolchlorobenzene3-halophenol3-chlorophenolhalobenzoic acid4-halobenzoic acid4-chlorophenolhalobenzoic acid or derivativesaryl halide4-halobenzoic acid or derivativesaromatic homomonocyclic compound2-halophenolvinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativehalobenzeneorganooxygen compound |
|---|
