| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:22:12 UTC |
|---|
| Update Date | 2025-03-21 18:37:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00115685 |
|---|
| Frequency | 35.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H15N7O7 |
|---|
| Molecular Mass | 381.1033 |
|---|
| SMILES | Nc1nc2nc3c(=O)[nH]c(=O)nc-3n(CC(O)C(O)C(O)CO)c2c(=O)[nH]1 |
|---|
| InChI Key | AFAMKAJMNKFZKK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsprimary alcoholsprimary aminespyrazinespyrimidonessecondary alcohols |
|---|
| Substituents | alcoholpterincarbonic acid derivativelactamazacycleheteroaromatic compoundpyrimidonepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundprimary alcoholamineorganooxygen compound |
|---|
