| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:22:14 UTC |
|---|
| Update Date | 2025-03-21 18:37:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00115750 |
|---|
| Frequency | 40.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H29NO13 |
|---|
| Molecular Mass | 455.1639 |
|---|
| SMILES | CC(=O)NC1C(OC(C(O)CO)C(O)C(O)C=O)OC(CO)C(O)C1OC(C)C(=O)O |
|---|
| InChI Key | FUJCQYGJNCPSAF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesalpha-hydroxyaldehydesbeta-hydroxy aldehydescarboxylic acidsdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidessugar acids and derivatives |
|---|
| Substituents | beta-hydroxy aldehydecarbonyl groupethercarboxylic acidmonosaccharidecarboxylic acid derivativedialkyl ethern-acyl-alpha-hexosaminemuramic_acidorganic oxidealpha-hydroxyaldehydeacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholaldehydecarboxamide groupoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativessecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
|---|