| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:22:19 UTC |
|---|
| Update Date | 2025-03-21 18:37:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00115961 |
|---|
| Frequency | 22.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H21NO2 |
|---|
| Molecular Mass | 223.1572 |
|---|
| SMILES | CC(C)CC1NC(=O)C2CCCCC2C1=O |
|---|
| InChI Key | JNQRBMQHLFDPPT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | isoquinolines and derivatives |
|---|
| Subclass | isoquinolones and derivatives |
|---|
| Direct Parent | isoquinolones and derivatives |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarboxylic acids and derivativesdelta lactamshydrocarbon derivativesketonesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperidinedionessecondary carboxylic acid amides |
|---|
| Substituents | carbonyl grouplactamazacyclecarboxamide groupcarboxylic acid derivativedelta-lactamketonealiphatic heteropolycyclic compoundsecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundpiperidinedioneisoquinolonepiperidinonehydrocarbon derivativeorganic nitrogen compoundpiperidineorganooxygen compound |
|---|
