| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:22:21 UTC |
|---|
| Update Date | 2025-03-21 18:37:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00116023 |
|---|
| Frequency | 22.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H16O10 |
|---|
| Molecular Mass | 428.0743 |
|---|
| SMILES | O=C(O)C1OC(Oc2ccc3c(c2)oc2c4ccccc4oc(=O)c32)C(O)C(O)C1O |
|---|
| InChI Key | ZPZWMNMPFQFDHV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | coumestans |
|---|
| Direct Parent | coumestans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyransacetalsangular furanocoumarinsbenzofuransbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsfuransfuropyransglucuronic acid derivativesheteroaromatic compoundshydrocarbon derivativeslactonesmonocarboxylic acids and derivativesmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanesphenol etherspyran carboxylic acidspyranones and derivativessecondary alcohols |
|---|
| Substituents | furanphenol ethercarbonyl groupcarboxylic acidglucuronic acid or derivatives1-benzopyrano-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acidlactone1-o-glucuronidebeta-hydroxy acidsaccharideorganic oxideacetalaromatic heteropolycyclic compoundpyranoneoxaneorganoheterocyclic compoundalcoholfuranocoumarinbenzopyranpyran carboxylic acid or derivativesbenzofuranheteroaromatic compoundhydroxy acidfuropyrancoumarinangular furanocoumarinoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyransecondary alcoholcoumestanhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
