Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-21 00:22:21 UTC |
---|
Update Date | 2025-03-21 18:37:31 UTC |
---|
HMDB ID | HMDB0304915 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00116047 |
---|
Name | 2-(4-Methoxyphenyl)ethyl hydrogen sulfate |
---|
Frequency | 22.6 |
---|
Structure | |
---|
Chemical Formula | C9H12O5S |
---|
Molecular Mass | 232.0405 |
---|
SMILES | COc1ccc(CCOS(=O)(=O)O)cc1 |
---|
InChI Key | LIEMNMRUKMNDIT-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | phenols |
---|
Subclass | tyrosols and derivatives |
---|
Direct Parent | tyrosols and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alkyl aryl ethersalkyl sulfatesanisoleshydrocarbon derivativesmethoxybenzenesorganic oxidesphenoxy compoundssulfuric acid monoesters |
---|
Substituents | phenol ethermonocyclic benzene moietysulfuric acid monoesteretherorganic sulfuric acid or derivativesalkyl aryl ethermethoxybenzenearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundanisolealkyl sulfatesulfate-esterhydrocarbon derivativetyrosol derivativephenoxy compoundsulfuric acid esterorganooxygen compound |
---|