| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:22:22 UTC |
|---|
| Update Date | 2025-03-21 18:37:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00116075 |
|---|
| Frequency | 22.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H10N3O4P |
|---|
| Molecular Mass | 231.0409 |
|---|
| SMILES | N=C(N)Nc1ccc(OP(=O)(O)O)cc1 |
|---|
| InChI Key | HPCMTWZQAUONBO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | phenyl phosphates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carboximidamidesguanidineshydrocarbon derivativesiminesorganic oxidesorganooxygen compoundsorganopnictogen compoundsphenoxy compounds |
|---|
| Substituents | monocyclic benzene moietyguanidineiminecarboximidamidephenyl phosphatearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
