| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:22:25 UTC |
|---|
| Update Date | 2025-03-21 18:37:33 UTC |
|---|
| HMDB ID | HMDB0260228 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00116192 |
|---|
| Name | [(3S,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl] octadec-9-enoate |
|---|
| Frequency | 22.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H44O7 |
|---|
| Molecular Mass | 444.3087 |
|---|
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | LUXUAZKGQZPOBZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acyl glycosides |
|---|
| Direct Parent | fatty acyl glycosides of mono- and disaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl compoundscarboxylic acid estersfatty acid estershydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholfatty acyl glycoside of mono- or disaccharidecarbonyl groupmonosaccharidecarboxylic acid derivativeoxacyclefatty acid estersaccharideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundacetalcarboxylic acid esteraliphatic heteromonocyclic compoundsecondary alcoholhydrocarbon derivativeoxaneprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|
