Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:22:26 UTC |
---|
Update Date | 2025-03-21 18:37:34 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00116238 |
---|
Frequency | 22.6 |
---|
Structure | |
---|
Chemical Formula | C15H23N3O17P2 |
---|
Molecular Mass | 579.0503 |
---|
SMILES | Nc1ccn(C2OC(COP(=O)(O)OP(=O)(O)OC3OC(C(=O)O)C(O)C(O)C3O)C(O)C2O)c(=O)n1 |
---|
InChI Key | RAIHIWVONZOABU-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | nucleosides, nucleotides, and analogues |
---|
Class | pyrimidine nucleotides |
---|
Subclass | pyrimidine ribonucleotides |
---|
Direct Parent | pyrimidine ribonucleoside diphosphates |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | amino acidsazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganic pyrophosphatesorganopnictogen compoundsoxacyclic compoundsoxanespentose phosphatesprimary aminespyran carboxylic acidspyrimidonessecondary alcoholstetrahydrofurans |
---|
Substituents | carbonyl groupcarboxylic acidglucuronic acid or derivativesaromatic heteromonocyclic compoundpentose phosphateamino acid or derivativesamino acidmonosaccharidepentose-5-phosphatepyrimidonecarboxylic acid derivativepyran carboxylic acidpyrimidinebeta-hydroxy acidsaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundoxaneimidolactamorganoheterocyclic compoundalcoholcarbonic acid derivativepyran carboxylic acid or derivativesazacycletetrahydrofuranheteroaromatic compoundhydroxy acidorganic pyrophosphateoxacyclemonocarboxylic acid or derivativespyrimidine ribonucleoside diphosphateorganic oxygen compoundphosphoric acid esterpyranmonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
---|