| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:22:31 UTC |
|---|
| Update Date | 2025-03-21 18:37:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00116447 |
|---|
| Frequency | 22.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10N4O4 |
|---|
| Molecular Mass | 250.0702 |
|---|
| SMILES | Cn1c(N)c(NC(=O)c2ccco2)c(=O)[nH]c1=O |
|---|
| InChI Key | WZPSSCHQRYQOMU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furans |
|---|
| Subclass | furoic acid and derivatives |
|---|
| Direct Parent | furoic acid and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-heteroaryl carboxamidesamino acids and derivativesazacyclic compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsprimary aminespyrimidonessecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | lactamaromatic heteromonocyclic compoundamino acid or derivativespyrimidonecarboxylic acid derivative2-heteroaryl carboxamidepyrimidineorganic oxideorganonitrogen compoundorganopnictogen compoundvinylogous amidefuroic acid or derivativescarbonic acid derivativeazacycleheteroaromatic compoundcarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
