| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:22:35 UTC |
|---|
| Update Date | 2025-03-21 18:37:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00116603 |
|---|
| Frequency | 22.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18NO11P |
|---|
| Molecular Mass | 407.0617 |
|---|
| SMILES | O=C1Nc2ccccc2OC1OC1OC(COP(=O)(O)O)C(O)C(O)C1O |
|---|
| InChI Key | FJLQMTGKLKKCHM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsazacyclic compoundsbenzenoidsbenzomorpholinesbenzoxazinonescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativeslactamsmonoalkyl phosphatesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl grouplactamcarboxylic acid derivativebenzomorpholineorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundalcoholazacyclebenzoxazinecarboxamide groupoxazinaneoxacyclesecondary carboxylic acid amidemorpholinebenzoxazinonephosphoric acid estermonoalkyl phosphatesecondary alcoholhexose phosphatehydrocarbon derivativebenzenoidorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
