| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:22:36 UTC |
|---|
| Update Date | 2025-03-21 18:37:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00116630 |
|---|
| Frequency | 22.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H19O13P |
|---|
| Molecular Mass | 390.0563 |
|---|
| SMILES | O=C1OC(COP(=O)(O)OC2OC(CO)C(O)C(O)C2O)C(O)C1O |
|---|
| InChI Key | NBSSDIGHQFCTBE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | dialkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid estersgamma butyrolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | carbonyl groupmonosaccharidecarboxylic acid derivativelactonesaccharideorganic oxidealiphatic heteromonocyclic compoundoxaneprimary alcoholorganoheterocyclic compoundalcoholtetrahydrofurangamma butyrolactoneoxacycledialkyl phosphatemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
