| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:22:41 UTC |
|---|
| Update Date | 2025-03-21 18:37:42 UTC |
|---|
| HMDB ID | HMDB0036293 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00116846 |
|---|
| Name | Cholesteryl ferulate |
|---|
| Frequency | 22.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C37H54O4 |
|---|
| Molecular Mass | 562.4022 |
|---|
| SMILES | COc1cc(C=CC(=O)OC2CCC3(C)C(=CCC4C3CCC3(C)C(C(C)CCCC(C)C)CCC43)C2)ccc1O |
|---|
| InChI Key | CPBQNAKTSMCPNH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | steroid esters |
|---|
| Direct Parent | cholesteryl esters |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolescarbonyl compoundscholesterols and derivativesdelta-5-steroidsenoate estershydrocarbon derivativeshydroxycinnamic acidsmethoxybenzenesmethoxyphenolsmonocarboxylic acids and derivativesorganic oxidesphenoxy compounds |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupether1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl ethercarboxylic acid derivativehydroxycinnamic acid or derivativesalpha,beta-unsaturated carboxylic estercinnamic acid or derivativesorganic oxidedelta-5-steroidenoate esteraromatic homopolycyclic compoundmethoxybenzenecholesterolhydroxycinnamic acidmonocarboxylic acid or derivativesorganic oxygen compoundanisolecarboxylic acid esterphenolhydrocarbon derivativebenzenoidcholestane-skeletonphenoxy compoundcholesteryl esterorganooxygen compound |
|---|
