| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:22:47 UTC |
|---|
| Update Date | 2025-03-21 18:37:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00117123 |
|---|
| Frequency | 22.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H12N2O4 |
|---|
| Molecular Mass | 200.0797 |
|---|
| SMILES | O=C(NC(CO)C(=O)O)C1CCC=N1 |
|---|
| InChI Key | ARTZKFJJAQXLLT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | n-acyl-alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesiminesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsprimary alcoholspropargyl-type 1,3-dipolar organic compoundspyrroline carboxylic acids and derivativessecondary carboxylic acid amidesserine and derivatives |
|---|
| Substituents | carbonyl groupcarboxylic acidiminepropargyl-type 1,3-dipolar organic compoundbeta-hydroxy acidorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundprimary alcoholorganoheterocyclic compoundalcoholazacyclen-acyl-alpha-amino acidpyrroline carboxylic acid or derivativesorganic 1,3-dipolar compoundhydroxy acidcarboxamide groupsecondary carboxylic acid amidemonocarboxylic acid or derivativespyrrolineorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundserine or derivativesorganooxygen compound |
|---|
