| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:22:49 UTC |
|---|
| Update Date | 2025-03-21 18:37:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00117191 |
|---|
| Frequency | 22.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16O10 |
|---|
| Molecular Mass | 296.0743 |
|---|
| SMILES | O=C(O)C1C(O)CC(O)(C(=O)O)OC1C(O)C(O)CO |
|---|
| InChI Key | GWUWCQQILIVLFV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | c-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshemiacetalshydrocarbon derivativesorganic oxidesoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | c-glucuronidealcoholcarbonyl groupcarboxylic acidpyran carboxylic acid or derivativesalpha-hydroxy acidhydroxy acidcarboxylic acid derivativepyran carboxylic acidoxacyclebeta-hydroxy acidorganic oxidepyranaliphatic heteromonocyclic compoundsecondary alcoholdicarboxylic acid or derivativeshemiacetalhydrocarbon derivativeoxaneprimary alcoholorganoheterocyclic compound |
|---|
