| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:22:50 UTC |
|---|
| Update Date | 2025-03-21 18:37:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00117243 |
|---|
| Frequency | 22.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15NO4 |
|---|
| Molecular Mass | 225.1001 |
|---|
| SMILES | OC1C=CC(NCc2ccco2)C(O)C1O |
|---|
| InChI Key | MCVNSZSZKJOTPU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclitols and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | dialkylaminesfuransheteroaromatic compoundshydrocarbon derivativesorganopnictogen compoundsoxacyclic compoundssecondary alcohols |
|---|
| Substituents | furansecondary aliphatic aminearomatic heteromonocyclic compoundheteroaromatic compoundcyclitol or derivativessecondary amineoxacycleorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundamine |
|---|
