| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:22:53 UTC |
|---|
| Update Date | 2025-03-21 18:37:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00117363 |
|---|
| Frequency | 22.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18N2O2 |
|---|
| Molecular Mass | 246.1368 |
|---|
| SMILES | CC(=O)N1CCN(C(=O)Cc2ccccc2)CC1 |
|---|
| InChI Key | MNXMHGQWQIKEEU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperazinestertiary carboxylic acid amides |
|---|
| Substituents | carbonyl grouparomatic heteromonocyclic compoundazacyclecarboxamide groupcarboxylic acid derivativeorganic oxideorganic oxygen compoundpiperazine1,4-diazinanetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenylacetamideorganoheterocyclic compoundacetamideorganooxygen compound |
|---|
