| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:01 UTC |
|---|
| Update Date | 2025-03-21 18:37:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00117672 |
|---|
| Frequency | 22.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C31H35N3O |
|---|
| Molecular Mass | 465.278 |
|---|
| SMILES | CN(C)C(=O)C(CCN1CCC(c2c[nH]c3ccccc23)CC1)(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | NEAAWFOTMGOXPR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesindolesn-acyl aminesorganic oxidesorganopnictogen compoundsphenylacetamidespiperidinespyrrolestertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | diphenylmethanecarbonyl groupamino acid or derivativesindolecarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpiperidinephenylacetamidetertiary amineorganoheterocyclic compoundazacycleheteroaromatic compoundtertiary aliphatic amineindole or derivativescarboxamide groupn-acyl-amineorganic oxygen compoundpyrrolehydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
