| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:09 UTC |
|---|
| Update Date | 2025-03-21 18:37:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00118001 |
|---|
| Frequency | 22.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H16F3N5S2 |
|---|
| Molecular Mass | 351.0799 |
|---|
| SMILES | CSCCNc1nc(SCCC(F)(F)F)nc2c1ncn2C |
|---|
| InChI Key | KFZCSZJZUPSNSC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesalkylarylthioethersazacyclic compoundsdialkylthioethersheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganofluoridesorganopnictogen compoundspyrimidines and pyrimidine derivativessecondary alkylarylaminessulfenyl compounds |
|---|
| Substituents | alkylarylthioetherorganosulfur compoundorganohalogen compoundaryl thioetherpyrimidinearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundalkyl halideimidolactamazolen-substituted imidazolesulfenyl compoundazacyclealkyl fluorideorganofluoridedialkylthioetherheteroaromatic compoundsecondary aminesecondary aliphatic/aromatic aminethioetherhydrocarbon derivativepurineorganic nitrogen compoundamine |
|---|
