| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:12 UTC |
|---|
| Update Date | 2025-03-21 18:37:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00118142 |
|---|
| Frequency | 32.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15N5O3 |
|---|
| Molecular Mass | 265.1175 |
|---|
| SMILES | CC(O)C(O)c1cnc2[nH]c(N(C)C)nc(=O)c2n1 |
|---|
| InChI Key | KMOGJJNPYRWUDJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsaminopyrimidines and derivativesaromatic alcoholsazacyclic compoundsdialkylarylaminesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrazinespyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | aromatic alcoholalcoholvinylogous amidepterinazacycleheteroaromatic compoundpyrimidonepyrimidineaminopyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compounddialkylarylamineorganooxygen compound1,2-diol |
|---|
