| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:19 UTC |
|---|
| Update Date | 2025-03-21 18:37:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00118416 |
|---|
| Frequency | 22.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H5N3O5S |
|---|
| Molecular Mass | 194.995 |
|---|
| SMILES | O=C1NC(=O)C(NS(=O)(=O)O)N1 |
|---|
| InChI Key | YZIJGWUSEYGUGW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azolidines |
|---|
| Subclass | imidazolidines |
|---|
| Direct Parent | hydantoins |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdicarboximideshydrocarbon derivativesimidazolidinonesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssulfuric acid monoamides |
|---|
| Substituents | carbonyl groupcarbonic acid derivativeorganic sulfuric acid or derivativesazacyclealpha-amino acid or derivativescarboxylic acid derivativeorganic oxideorganic oxygen compoundhydantoinaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidsulfuric acid monoamideorganopnictogen compoundhydrocarbon derivativedicarboximideorganic nitrogen compoundorganooxygen compound |
|---|
