| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:22 UTC |
|---|
| Update Date | 2025-03-21 18:38:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00118520 |
|---|
| Frequency | 22.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14N2O3 |
|---|
| Molecular Mass | 222.1004 |
|---|
| SMILES | CN(C)c1ccccc1C(=O)NCC(=O)O |
|---|
| InChI Key | TXOXVHZFTQCNQS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 2-aminobenzamidesalpha amino acidsamino acidsaniline and substituted anilinesanthranilamidesbenzoyl derivativescarbonyl compoundscarboxylic acidsdialkylarylamineshippuric acids and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidamino acid2-aminobenzamidebenzoylbenzamideorganic oxidetertiary aliphatic/aromatic amineorganonitrogen compoundalpha-amino acidorganopnictogen compounddialkylarylamineaminobenzoic acid or derivativestertiary aminevinylogous amidehippuric acid or derivativesaniline or substituted anilinesbenzoic acid or derivativescarboxamide groupaminobenzamiden-acylglycinearomatic homomonocyclic compoundsecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundanthranilamidehydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
