| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:22 UTC |
|---|
| Update Date | 2025-03-21 18:38:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00118541 |
|---|
| Frequency | 22.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H15NO2 |
|---|
| Molecular Mass | 241.1103 |
|---|
| SMILES | Nc1ccccc1C(=O)CCc1ccc(O)cc1 |
|---|
| InChI Key | QOMIJIIVVPNQLV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | chalcones and dihydrochalcones |
|---|
| Direct Parent | retro-dihydrochalcones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl-phenylketonesaryl alkyl ketonesbenzoyl derivativesbutyrophenonescinnamylphenolshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminesvinylogous amides |
|---|
| Substituents | monocyclic benzene moietyaryl alkyl ketonebenzoyl1-hydroxy-2-unsubstituted benzenoidcinnamylphenolretro-dihydrochalconeketoneorganic oxideorganonitrogen compoundorganopnictogen compoundvinylogous amidephenylketonebutyrophenonearomatic homomonocyclic compoundorganic oxygen compoundphenolhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundaminealkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|
