| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:23 UTC |
|---|
| Update Date | 2025-03-21 18:38:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00118564 |
|---|
| Frequency | 22.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H6O8S |
|---|
| Molecular Mass | 261.9783 |
|---|
| SMILES | O=C(O)c1ccc(C(=O)O)c(OS(=O)(=O)O)c1 |
|---|
| InChI Key | XZPGDGUSWZGCSC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | p-phthalic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsbenzoic acidsbenzoyl derivativesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsphenoxy compoundsphenylsulfatessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarboxylic acidorganic sulfuric acid or derivativesbenzoylcarboxylic acid derivativearomatic homomonocyclic compoundphenylsulfateorganic oxideorganic oxygen compounddicarboxylic acid or derivativessulfate-esterhydrocarbon derivativearylsulfate1-carboxy-2-haloaromatic compoundbenzoic acidphenoxy compoundsulfuric acid esterorganooxygen compoundpara_phthalic_acid |
|---|
