DeepMet

Record Information
HMDB Status	expected
Creation Date	2024-02-21 00:23:27 UTC
Update Date	2025-03-21 18:38:03 UTC
HMDB ID	HMDB0039733
Metabolite Identification
DeepMet ID	DMID00118719
Name	gamma-Glutamylcysteinylserine
Frequency	32.1
Structure
Chemical Formula	C₁₁H₁₉N₃O₇S
Molecular Mass	337.0944
SMILES	NC(CCC(=O)NC(CS)C(=O)NC(CO)C(=O)O)C(=O)O
InChI Key	QWHVIVGONDEFNH-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic acids and derivatives
Class	carboxylic acids and derivatives
Subclass	amino acids, peptides, and analogues
Direct Parent	oligopeptides
Geometric Descriptor	aliphatic acyclic compounds
Alternative Parents	alkylthiols alpha amino acid amides alpha amino acids beta hydroxy acids and derivatives carbonyl compounds carboxylic acids cysteine and derivatives dicarboxylic acids and derivatives fatty acids and conjugates glutamine and derivatives hydrocarbon derivatives monoalkylamines n-acyl amines n-acyl-alpha amino acids organic oxides organonitrogen compounds organopnictogen compounds organosulfur compounds primary alcohols secondary carboxylic acid amides serine and derivatives short-chain hydroxy acids and derivatives
Substituents	fatty acyl aliphatic acyclic compound carbonyl group carboxylic acid short-chain hydroxy acid glutamine or derivatives fatty amide fatty acid alpha-amino acid or derivatives organosulfur compound beta-hydroxy acid organic oxide organonitrogen compound alpha-amino acid organopnictogen compound primary alcohol n-acyl-alpha amino acid or derivatives alcohol alpha-amino acid amide n-acyl-alpha-amino acid hydroxy acid carboxamide group n-acyl-amine n-substituted-alpha-amino acid secondary carboxylic acid amide organic oxygen compound cysteine or derivatives dicarboxylic acid or derivatives hydrocarbon derivative primary aliphatic amine alpha-oligopeptide organic nitrogen compound serine or derivatives alkylthiol organooxygen compound

Showing information for DMID00118719