| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:27 UTC |
|---|
| Update Date | 2025-03-21 18:38:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00118739 |
|---|
| Frequency | 22.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H21NO4 |
|---|
| Molecular Mass | 315.1471 |
|---|
| SMILES | COc1ccc2c3c1OC1C(O)C=CC4C(C2O)N(C)CCC341 |
|---|
| InChI Key | ZDGQZOCAKDGPRA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | morphinans |
|---|
| Subclass | morphinans |
|---|
| Direct Parent | morphinans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsalkyl aryl ethersanisolesazacyclic compoundscoumaranshydrocarbon derivativesorganopnictogen compoundsoxacyclic compoundsphenanthrenes and derivativespiperidinessecondary alcoholstetralinstrialkylamines |
|---|
| Substituents | tetralinphenol etheretheralkyl aryl etheraromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundcoumaranalcoholphenanthreneazacycle1,2-aminoalcoholtertiary aliphatic amineoxacycleorganic oxygen compoundanisolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundmorphinanamineorganooxygen compound |
|---|
