| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:23:31 UTC |
|---|
| Update Date | 2025-03-21 18:38:05 UTC |
|---|
| HMDB ID | HMDB0245146 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00118891 |
|---|
| Name | 2-Hydroxy-5-(trifluoromethoxy)benzoic Acid |
|---|
| Frequency | 22.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H5F3O4 |
|---|
| Molecular Mass | 222.014 |
|---|
| SMILES | O=C(O)c1cc(OC(F)(F)F)ccc1O |
|---|
| InChI Key | HNYMLXYADOZCNY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | salicylic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoids4-alkoxyphenolsalkyl fluoridesbenzoic acidsbenzoyl derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluoridesorganooxygen compoundsphenol ethersphenoxy compoundstrihalomethanesvinylogous acids |
|---|
| Substituents | phenol ethercarboxylic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidsalicylic acidcarboxylic acid derivativeorganohalogen compoundorganic oxidealkyl halide1-carboxy-2-haloaromatic compoundbenzoic acidhalomethane4-alkoxyphenoltrihalomethanealkyl fluorideorganofluoridearomatic homomonocyclic compoundvinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
