| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:23:31 UTC |
|---|
| Update Date | 2025-03-21 18:38:05 UTC |
|---|
| HMDB ID | HMDB0135603 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00118900 |
|---|
| Name | 1-(4-hydroxyphenyl)-3-phenylprop-2-en-1-one |
|---|
| Frequency | 21.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12O2 |
|---|
| Molecular Mass | 224.0837 |
|---|
| SMILES | O=C(C=Cc1ccccc1)c1ccc(O)cc1 |
|---|
| InChI Key | UAHGNXFYLAJDIN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | cinnamylphenols |
|---|
| Direct Parent | cinnamylphenols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha,beta-unsaturated ketonesaryl ketonesbenzoyl derivativescinnamic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compounds |
|---|
| Substituents | monocyclic benzene moietybenzoyl1-hydroxy-2-unsubstituted benzenoidcinnamylphenolalpha,beta-unsaturated ketoneketonearomatic homomonocyclic compoundcinnamic acid or derivativesorganic oxideorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|
