| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:33 UTC |
|---|
| Update Date | 2025-03-21 18:38:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00118965 |
|---|
| Frequency | 21.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H21N3O3 |
|---|
| Molecular Mass | 267.1583 |
|---|
| SMILES | CC(C)NCC(O)COc1ccc(NC(N)=O)cc1 |
|---|
| InChI Key | FGMUQNDVAWYYSW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | n-phenylureas |
|---|
| Direct Parent | n-phenylureas |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl etherscarbonyl compoundsdialkylamineshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsphenol ethersphenoxy compoundssecondary alcohols |
|---|
| Substituents | alcoholphenol ethersecondary aliphatic aminecarbonyl groupethercarbonic acid derivativealkyl aryl ethersecondary aminearomatic homomonocyclic compoundn-phenylureaorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compoundamine |
|---|
