| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:33 UTC |
|---|
| Update Date | 2025-03-21 18:38:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00118982 |
|---|
| Frequency | 21.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C29H38N4O4S |
|---|
| Molecular Mass | 538.2614 |
|---|
| SMILES | CC(C)CN(CC(O)C(Cc1ccccc1)NC(=O)C(N)Cc1ccccc1)S(=O)(=O)c1ccc(N)cc1 |
|---|
| InChI Key | OWMAXSJGTBLFRR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | phenylalanine and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acid amidesalpha amino acidsaminosulfonyl compoundsamphetamines and derivativesbenzenesulfonamidesbenzenesulfonyl compoundscarbonyl compoundscarboxylic acids and derivativesfatty amideshydrocarbon derivativesmonoalkylaminesorganic oxidesorganopnictogen compoundsorganosulfonamidesphenylbutylaminessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylorganosulfonic acid or derivativesmonocyclic benzene moietycarbonyl groupfatty amideorganosulfur compoundorganosulfonic acid amideorganic oxidephenylbutylamineorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesbenzenesulfonyl groupalcoholbenzenesulfonamidealpha-amino acid amideaminosulfonyl compoundcarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amidesulfonylphenylalanine or derivativesorganic oxygen compoundorganic sulfonic acid or derivativessecondary alcoholhydrocarbon derivativebenzenoidprimary aliphatic amineprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
