| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:39 UTC |
|---|
| Update Date | 2025-03-21 18:38:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00119197 |
|---|
| Frequency | 21.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H14O5 |
|---|
| Molecular Mass | 262.0841 |
|---|
| SMILES | COc1cc(Cc2c(O)cc(O)cc2O)ccc1O |
|---|
| InChI Key | OIPMZTXUWSBPNM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersanisoleshydrocarbon derivativesmethoxybenzenesmethoxyphenolsphenoxy compoundsphloroglucinols and derivatives |
|---|
| Substituents | diphenylmethanephenol etheretherbenzenetriol1-hydroxy-2-unsubstituted benzenoidmethoxyphenol1-hydroxy-4-unsubstituted benzenoidalkyl aryl ethermethoxybenzenephloroglucinol derivativearomatic homomonocyclic compoundorganic oxygen compoundanisolephenolhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
