| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:41 UTC |
|---|
| Update Date | 2025-03-21 18:38:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00119269 |
|---|
| Frequency | 21.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16O9 |
|---|
| Molecular Mass | 280.0794 |
|---|
| SMILES | CC(OC1C(O)C(O)C(O)C(C(=O)O)C1O)C(=O)O |
|---|
| InChI Key | GPIJAVMGFKEXOO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | beta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclitols and derivativesdialkyl ethersdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxides |
|---|
| Substituents | carbonyl groupethercarboxylic acidcyclohexanolcyclitol or derivativeshydroxy acidcyclic alcoholcarboxylic acid derivativedialkyl etherbeta-hydroxy acidorganic oxidealiphatic homomonocyclic compounddicarboxylic acid or derivativeshydrocarbon derivative |
|---|
