| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:23:44 UTC |
|---|
| Update Date | 2025-03-21 18:38:10 UTC |
|---|
| HMDB ID | HMDB0252194 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00119365 |
|---|
| Name | Fenclofenac |
|---|
| Frequency | 21.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H10Cl2O3 |
|---|
| Molecular Mass | 296.0007 |
|---|
| SMILES | O=C(O)Cc1ccccc1Oc1ccc(Cl)cc1Cl |
|---|
| InChI Key | IDKAXRLETRCXKS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chloridescarbonyl compoundscarboxylic acidsdiarylethersdichlorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridesphenol ethersphenoxy compounds |
|---|
| Substituents | aryl chloridechlorobenzenediaryl etherphenol ethercarbonyl groupethercarboxylic acidorganochloridecarboxylic acid derivativeorganohalogen compoundaryl halide1,3-dichlorobenzenearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativehalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|
