| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:47 UTC |
|---|
| Update Date | 2025-03-21 18:38:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00119505 |
|---|
| Frequency | 33.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H9N4O7P |
|---|
| Molecular Mass | 316.0209 |
|---|
| SMILES | O=c1[nH]cnc2c1ncn2C1OC2COP(=O)(O)OC2O1 |
|---|
| InChI Key | KIPNPKWNXIFPGW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundspurines and purine derivativespyrimidonesvinylogous amides |
|---|
| Substituents | meta-dioxolanelactampyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundazolen-substituted imidazolevinylogous amideazacycleheteroaromatic compoundoxacycleorganic oxygen compoundhypoxanthinehydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compound |
|---|
