| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:47 UTC |
|---|
| Update Date | 2025-03-21 18:38:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00119511 |
|---|
| Frequency | 21.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H15NO2 |
|---|
| Molecular Mass | 265.1103 |
|---|
| SMILES | CC(C(=O)c1c[nH]c2ccccc12)c1ccc(O)cc1 |
|---|
| InChI Key | PLXJSNOMIHGUIW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | phenylacetylindoles |
|---|
| Direct Parent | phenylacetylindoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl alkyl ketonesazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesindolesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrrolesvinylogous amides |
|---|
| Substituents | vinylogous amidemonocyclic benzene moietyaryl alkyl ketoneazacycleindoleheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidketoneorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundphenylacetylindoleorganooxygen compoundaryl ketone |
|---|
