| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:48 UTC |
|---|
| Update Date | 2025-03-21 18:38:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00119525 |
|---|
| Frequency | 21.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H13N3O3 |
|---|
| Molecular Mass | 259.0957 |
|---|
| SMILES | COc1ccc2[nH]cc(CC3NC(=O)NC3=O)c2c1 |
|---|
| InChI Key | ZTQQCNMUBZXWCH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azolidines |
|---|
| Subclass | imidazolidines |
|---|
| Direct Parent | hydantoins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha amino acidsanisolesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdicarboximidesheteroaromatic compoundshydrocarbon derivativesimidazolidinonesindolesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrroles |
|---|
| Substituents | phenol ethercarbonyl groupetherindolealpha-amino acid or derivativesalkyl aryl ethercarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximidecarbonic acid derivativeazacycleheteroaromatic compoundindole or derivativesorganic oxygen compoundhydantoinanisolepyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
