| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:49 UTC |
|---|
| Update Date | 2025-03-21 18:38:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00119556 |
|---|
| Frequency | 30.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H9N5O |
|---|
| Molecular Mass | 239.0807 |
|---|
| SMILES | Nc1nc2ncnc(O)c2nc1-c1ccccc1 |
|---|
| InChI Key | BLIHWRGWDGGVFL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesimidolactamsorganooxygen compoundsorganopnictogen compoundsprimary aminespyrazines |
|---|
| Substituents | monocyclic benzene moietyazacycleheteroaromatic compoundhydroxypyrimidinepteridinepyrimidineorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundimidolactamamineorganooxygen compound |
|---|
