| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:49 UTC |
|---|
| Update Date | 2025-03-21 18:38:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00119580 |
|---|
| Frequency | 21.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15O5PS |
|---|
| Molecular Mass | 290.0378 |
|---|
| SMILES | CCOP(=S)(OCC)Oc1ccccc1C(=O)O |
|---|
| InChI Key | UTRBNCPUJLOTRY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic thiophosphoric acids and derivatives |
|---|
| Subclass | thiophosphoric acid esters |
|---|
| Direct Parent | phenyl thiophosphates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsbenzoic acidsbenzoyl derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsphenoxy compoundsthiophosphate triesters |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidbenzoylbenzoic acid or derivativesphenyl thiophosphatecarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidthiophosphate triester1-carboxy-2-haloaromatic compoundbenzoic acidphenoxy compoundorganooxygen compound |
|---|
