| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:51 UTC |
|---|
| Update Date | 2025-03-21 18:38:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00119634 |
|---|
| Frequency | 21.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H16N2O2S |
|---|
| Molecular Mass | 252.0932 |
|---|
| SMILES | CN(C)CCN1C(=O)C(O)Sc2ccccc21 |
|---|
| InChI Key | WAFVUHZOLNEHPW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzothiazines |
|---|
| Subclass | benzothiazines |
|---|
| Direct Parent | benzothiazines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,4-thiazinesamino acids and derivativesaryl thioethersazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativeslactamsorganic oxidesorganopnictogen compoundstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | carbonyl grouppara-thiazinelactamazacycleamino acid or derivativestertiary aliphatic aminebenzothiazinecarboxamide groupcarboxylic acid derivativearyl thioetherorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|
