| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:52 UTC |
|---|
| Update Date | 2025-03-21 18:38:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00119684 |
|---|
| Frequency | 21.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H41NO20 |
|---|
| Molecular Mass | 663.2222 |
|---|
| SMILES | CC(=O)NC1CC(OC2OC(CO)C(O)C(O)C2O)(OC2OC(CO)C(O)C(O)C2O)OC1OC1C(CO)OC(O)C(O)C1O |
|---|
| InChI Key | JXOWQNKSYCYLBP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | orthocarboxylic acid derivatives |
|---|
| Subclass | carboxylic acid orthoesters |
|---|
| Direct Parent | carboxylic acid orthoesters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidescarbonyl compoundscarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | carbonyl grouportho estermonosaccharidecarboxylic acid orthoestercarboxylic acid derivativesaccharideorganic oxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholtetrahydrofurancarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
