| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:23:54 UTC |
|---|
| Update Date | 2025-03-21 18:38:14 UTC |
|---|
| HMDB ID | HMDB0038336 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00119752 |
|---|
| Name | 2-Hydroxy-3-(3,4-dihydroxyphenyl)propanamide |
|---|
| Frequency | 21.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11NO4 |
|---|
| Molecular Mass | 197.0688 |
|---|
| SMILES | NC(=O)C(O)Cc1ccc(O)c(O)c1 |
|---|
| InChI Key | UZRUFOMXLWRIQS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Direct Parent | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesfatty amideshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidessecondary alcohols |
|---|
| Substituents | primary carboxylic acid amidealcoholfatty acylmonocyclic benzene moietycarbonyl groupfatty amide1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidcarboxamide groupcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
