| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:23:59 UTC |
|---|
| Update Date | 2025-03-21 18:38:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00119951 |
|---|
| Frequency | 21.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H9Cl2NO |
|---|
| Molecular Mass | 277.0061 |
|---|
| SMILES | O=C1NC(c2ccc(Cl)c(Cl)c2)c2ccccc21 |
|---|
| InChI Key | NEOCTUUNBRCXOS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | isoindoles and derivatives |
|---|
| Subclass | isoindolines |
|---|
| Direct Parent | isoindolones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl chloridesazacyclic compoundscarboxylic acids and derivativesdichlorobenzeneshydrocarbon derivativesisoindoleslactamsorganic oxidesorganochloridesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietylactamorganochloridecarboxylic acid derivativeorganohalogen compoundisoindoloneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound1,2-dichlorobenzenearyl chloridechlorobenzeneazacycleisoindolecarboxamide grouparyl halidesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
