| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:24:02 UTC |
|---|
| Update Date | 2025-03-21 18:38:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00120061 |
|---|
| Frequency | 21.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13N2O12PS |
|---|
| Molecular Mass | 403.9927 |
|---|
| SMILES | O=c1ccn(C2OC(COS(=O)(=O)O)C(OP(=O)(O)O)C2O)c(=O)[nH]1 |
|---|
| InChI Key | FYBKZIREEFZPCL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | ribonucleoside 3'-phosphates |
|---|
| Subclass | ribonucleoside 3'-phosphates |
|---|
| Direct Parent | ribonucleoside 3'-phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfatesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspentose phosphatespyrimidonessecondary alcoholssulfuric acid monoesterstetrahydrofuransvinylogous amides |
|---|
| Substituents | sulfuric acid monoesterlactamaromatic heteromonocyclic compoundpentose phosphatemonosaccharidepyrimidonepyrimidinesaccharideorganic oxidealkyl sulfateorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundribonucleoside 3'-phosphatealcoholvinylogous amidecarbonic acid derivativeorganic sulfuric acid or derivativesazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esterorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
